CAS 728877-98-3 appears in our catalog under these names: Methyl (2S,3S)-3-hydroxy-2-((triphenylmethyl)amino)butanoate, 95%, Methyl (2S,3S)-3-hydroxy-2-((triphenylmethyl)amino)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl (2S,3S)-3-hydroxy-2-(tritylamino)butanoate (CAS 728877-98-3) is a chemical compound with the molecular formula C24H25NO3 and a molecular weight of 375.5 g/mol. IUPAC name: methyl (2S,3S)-3-hydroxy-2-(tritylamino)butanoate. InChIKey: KXZWRQGFZBZTOO-AVRDEDQJSA-N.
| Molecular formula | C24H25NO3 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | methyl (2S,3S)-3-hydroxy-2-(tritylamino)butanoate |
| InChIKey | KXZWRQGFZBZTOO-AVRDEDQJSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)OC)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)