CAS 728948-88-7 appears in our catalog under these names: Levocetirizine Impurity 15 DiHCl, Cetirizine Impurity 15(Cetirizine EP Impurity G), (R)-De(carboxymethyl) Cetirizine Ethanol Dihydrochloride, >95% (HPLC), (R)-De(carboxymethyl) Cetirizine Ethanol Dihydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 0,25g.
2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanol (CAS 728948-88-7) is a chemical compound with the molecular formula C19H23ClN2O and a molecular weight of 330.8 g/mol. IUPAC name: 2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanol. InChIKey: ZJQSBXXYLQGZBR-LJQANCHMSA-N.
| Molecular formula | C19H23ClN2O |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanol |
| InChIKey | ZJQSBXXYLQGZBR-LJQANCHMSA-N |
| SMILES | C1CN(CCN1CCO)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)