CAS 72904-60-0 is the registry number for (2R,3S,4R,5R)-2-Amino-3,4,5,6-tetrahydroxyhexanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal (CAS 72904-60-0) is a chemical compound with the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. IUPAC name: (2R,3S,4R,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal. InChIKey: FZHXIRIBWMQPQF-FSIIMWSLSA-N.
| Molecular formula | C6H13NO5 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | FZHXIRIBWMQPQF-FSIIMWSLSA-N |
| SMILES | C([C@H]([C@@H]([C@H]([C@H](C=O)N)O)O)O)O |
Computed by PubChem (NCBI)