CAS 72908-02-2 is the registry number for (4-Chloro-2-methyl-3,5-dinitrophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(4-chloro-2-methyl-3,5-dinitrophenyl)methanol (CAS 72908-02-2) is a chemical compound with the molecular formula C8H7ClN2O5 and a molecular weight of 246.60 g/mol. IUPAC name: (4-chloro-2-methyl-3,5-dinitrophenyl)methanol. InChIKey: SJNNZMBYMXBMSS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O5 |
|---|---|
| Molecular weight | 246.60 g/mol |
| IUPAC name | (4-chloro-2-methyl-3,5-dinitrophenyl)methanol |
| InChIKey | SJNNZMBYMXBMSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1CO)[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)