Products 72934-38-4
CAS 72934-38-4 is the registry number for 1-Chloro-4-(1-isocyanatocyclopropyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-chloro-4-(1-isocyanatocyclopropyl)benzene (CAS 72934-38-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 1-chloro-4-(1-isocyanatocyclopropyl)benzene. InChIKey: MICJRBRRXHOBFQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 1-chloro-4-(1-isocyanatocyclopropyl)benzene |
| InChIKey | MICJRBRRXHOBFQ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Cl)N=C=O |
Computed by PubChem (NCBI)