CAS 72944-19-5 appears in our catalog under these names: Artepillin C, Artepillin C, Artepillin C, 95%, 95%, Artepillin C (Standard), Artepillin C, 98.28%. Offered by: GLPBio, Chemat Brand, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, on request, 1mg, 50mg, 10mg, 25mg, Get quote, 5 mg.
(E)-3-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]prop-2-enoic acid (CAS 72944-19-5) is a chemical compound with the molecular formula C19H24O3 and a molecular weight of 300.4 g/mol. IUPAC name: (E)-3-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]prop-2-enoic acid. InChIKey: KABCFARPAMSXCC-JXMROGBWSA-N.
| Molecular formula | C19H24O3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (E)-3-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| InChIKey | KABCFARPAMSXCC-JXMROGBWSA-N |
| SMILES | CC(=CCC1=CC(=CC(=C1O)CC=C(C)C)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)