CAS 72957-37-0 appears in our catalog under these names: Gly-His-Lys acetate salt, 95%, Gly–His–Lys acetate salt , Gly-His-Lys acetate salt, Liver-Cell Growth Factor, GLY-HIS-LYS ACETATE. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,1g, 0,25g, 25mg, 0,5g.
Acetic acid;(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid (CAS 72957-37-0) is a chemical compound with the molecular formula C16H28N6O6 and a molecular weight of 400.43 g/mol. IUPAC name: acetic acid;(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid. InChIKey: MGNUTAFMLGJBGV-ACMTZBLWSA-N.
| Molecular formula | C16H28N6O6 |
|---|---|
| Molecular weight | 400.43 g/mol |
| IUPAC name | acetic acid;(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| InChIKey | MGNUTAFMLGJBGV-ACMTZBLWSA-N |
| SMILES | CC(=O)O.C1=C(NC=N1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)