CAS 72978-16-6 appears in our catalog under these names: Pyrroline–5–carboxylate sodium, Pyrroline-5-carboxylate (sodium), 99.79%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 5 mg, 100 mg, 50 mg, 10 mg.
Sodium 3,4-dihydro-2H-pyrrole-5-carboxylate (CAS 72978-16-6) is a chemical compound with the molecular formula C5H6NNaO2 and a molecular weight of 135.10 g/mol. IUPAC name: sodium 3,4-dihydro-2H-pyrrole-5-carboxylate. InChIKey: QKIMVEBDSSQQKE-UHFFFAOYSA-M.
| Molecular formula | C5H6NNaO2 |
|---|---|
| Molecular weight | 135.10 g/mol |
| IUPAC name | sodium 3,4-dihydro-2H-pyrrole-5-carboxylate |
| InChIKey | QKIMVEBDSSQQKE-UHFFFAOYSA-M |
| SMILES | C1CC(=NC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)