CAS 7298-65-9 appears in our catalog under these names: 3-Oxo-3H-spiro(isobenzofuran-1,9'-xanthene)-3',6'-diyl dibutyrate, 97%, Fluorescein dibutyrate, Fluorescein dibutyrate, 3-Oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diyl dibutyrate, ≥98%, ≥98%. Offered by: AmBeed, GLPBio, Chemat, Biosynth. Available pack sizes: 100mg, 5g, 25g, 250mg, 1g.
(6'-butanoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) butanoate (CAS 7298-65-9) is a chemical compound with the molecular formula C28H24O7 and a molecular weight of 472.5 g/mol. IUPAC name: (6'-butanoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) butanoate. InChIKey: CGMHIZMGYHYHML-UHFFFAOYSA-N.
| Molecular formula | C28H24O7 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | (6'-butanoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) butanoate |
| InChIKey | CGMHIZMGYHYHML-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)CCC)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)