Products 72985-21-8

CAS 72985-21-8 is the registry number for 5-(Hydroxymethyl)-2-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(hydroxymethyl)-2-methylbenzoic acid (CAS 72985-21-8) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: 5-(hydroxymethyl)-2-methylbenzoic acid. InChIKey: VATJFXXKGNSLIW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O3
Molecular weight166.17 g/mol
IUPAC name5-(hydroxymethyl)-2-methylbenzoic acid
InChIKeyVATJFXXKGNSLIW-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)CO)C(=O)O

Computed by PubChem (NCBI)