CAS 7299-29-8 is the registry number for (1S,3S,5S,6R,8S)-3-Ethyl-5-(quinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S,8S)-3-ethyl-5-quinolin-4-yl-4-oxa-1-azatricyclo[4.4.0.03,8]decane (CAS 7299-29-8) is a chemical compound with the molecular formula C19H22N2O and a molecular weight of 294.4 g/mol. IUPAC name: (3R,5S,8S)-3-ethyl-5-quinolin-4-yl-4-oxa-1-azatricyclo[4.4.0.03,8]decane. InChIKey: IGOWXAXBICNYRL-KUGAQEKRSA-N.
| Molecular formula | C19H22N2O |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | (3R,5S,8S)-3-ethyl-5-quinolin-4-yl-4-oxa-1-azatricyclo[4.4.0.03,8]decane |
| InChIKey | IGOWXAXBICNYRL-KUGAQEKRSA-N |
| SMILES | CC[C@]12CN3CC[C@H]1CC3[C@@H](O2)C4=CC=NC5=CC=CC=C45 |
Computed by PubChem (NCBI)