Products 73036-54-1
CAS 73036-54-1 appears in our catalog under these names: 7–Ketoisodrimenin, 7-Ketoisodrimenin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(5aS,9aS)-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1,4-dione (CAS 73036-54-1) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (5aS,9aS)-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1,4-dione. InChIKey: DUXBZCLJTPCFOX-NHYWBVRUSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (5aS,9aS)-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1,4-dione |
| InChIKey | DUXBZCLJTPCFOX-NHYWBVRUSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC(=O)C3=C2C(=O)OC3)(C)C |
Computed by PubChem (NCBI)