CAS 7304-91-8 is the registry number for Diphenyl Selenoxide. Offered by: TRC. Available pack sizes: 100mg.
Phenylseleninylbenzene (CAS 7304-91-8) is a chemical compound with the molecular formula C12H10OSe and a molecular weight of 249.18 g/mol. IUPAC name: phenylseleninylbenzene. InChIKey: OOZCGWBPTPQVFX-UHFFFAOYSA-N.
| Molecular formula | C12H10OSe |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | phenylseleninylbenzene |
| InChIKey | OOZCGWBPTPQVFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se](=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)