Products 73069-28-0
CAS 73069-28-0 appears in our catalog under these names: Praeruptorin B, >95% (HPLC), Praeruptorin B, Praeruptorin B (Standard), Praeruptorin B, 99.95%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 100mg, 10mg, 2mg, Get quote, 100 mg, 50 mg, 10mM/1mL, 5 mg.
[8,8-dimethyl-9-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (E)-2-methylbut-2-enoate (CAS 73069-28-0) is a chemical compound with the molecular formula C24H26O7 and a molecular weight of 426.5 g/mol. IUPAC name: [8,8-dimethyl-9-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (E)-2-methylbut-2-enoate. InChIKey: PNTWXEIQXBRCPS-FNCQTZNRSA-N.
| Molecular formula | C24H26O7 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | [8,8-dimethyl-9-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (E)-2-methylbut-2-enoate |
| InChIKey | PNTWXEIQXBRCPS-FNCQTZNRSA-N |
| SMILES | C/C=C(\C)/C(=O)OC1C(C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)/C(=C/C)/C |
Computed by PubChem (NCBI)