CAS 7309-84-4 appears in our catalog under these names: Perfluoro(2-oxo-3,6-dimethyl-1,4-dioxane), 95%, Perfluoro(2-Oxo-3,6-Dimethyl-1,4-Dioxane). Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
3,5,5,6-tetrafluoro-3,6-bis(trifluoromethyl)-1,4-dioxan-2-one (CAS 7309-84-4) is a chemical compound with the molecular formula C6F10O3 and a molecular weight of 310.05 g/mol. IUPAC name: 3,5,5,6-tetrafluoro-3,6-bis(trifluoromethyl)-1,4-dioxan-2-one. InChIKey: CWRPQPNYDDMAMA-UHFFFAOYSA-N.
| Molecular formula | C6F10O3 |
|---|---|
| Molecular weight | 310.05 g/mol |
| IUPAC name | 3,5,5,6-tetrafluoro-3,6-bis(trifluoromethyl)-1,4-dioxan-2-one |
| InChIKey | CWRPQPNYDDMAMA-UHFFFAOYSA-N |
| SMILES | C1(=O)C(OC(C(O1)(C(F)(F)F)F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)