Products 73090-70-7

CAS 73090-70-7 is the registry number for Epiroprim. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 1 mg, 50 mg.

Structural formula: {0} (CAS {1})

5-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]pyrimidine-2,4-diamine (CAS 73090-70-7) is a chemical compound with the molecular formula C19H23N5O2 and a molecular weight of 353.4 g/mol. IUPAC name: 5-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]pyrimidine-2,4-diamine. InChIKey: NMARPFMJVCXSAV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H23N5O2
Molecular weight353.4 g/mol
IUPAC name5-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]pyrimidine-2,4-diamine
InChIKeyNMARPFMJVCXSAV-UHFFFAOYSA-N
SMILESCCOC1=CC(=CC(=C1N2C=CC=C2)OCC)CC3=CN=C(N=C3N)N

Computed by PubChem (NCBI)