Products 730960-98-2
CAS 730960-98-2 appears in our catalog under these names: Nsc 15520 >= 98 % HPLC 25 Mg, Nsc 15520 >= 98 % HPLC 5 Mg, NSC 15520, NSC15520, Fumaropimaric acid. Offered by: Sigma-Aldrich, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25MG, 5MG, 1mg, 10mg, 50mg, 100mg, 25 mg, 10 mg.
5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylic acid (CAS 730960-98-2) is a chemical compound with the molecular formula C24H34O6 and a molecular weight of 418.5 g/mol. IUPAC name: 5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylic acid. InChIKey: PXYRCOIAFZBLBN-UHFFFAOYSA-N.
| Molecular formula | C24H34O6 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylic acid |
| InChIKey | PXYRCOIAFZBLBN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC23CCC4C(C2CC1C(C3C(=O)O)C(=O)O)(CCCC4(C)C(=O)O)C |
Computed by PubChem (NCBI)