CAS 73099-88-4 is the registry number for Ticlopidine EP Impurity E Bromide. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium bromide (CAS 73099-88-4) is a chemical compound with the molecular formula C14H11BrClNS and a molecular weight of 340.7 g/mol. IUPAC name: 5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium bromide. InChIKey: QPAFJVNEPLDJFR-UHFFFAOYSA-M.
| Molecular formula | C14H11BrClNS |
|---|---|
| Molecular weight | 340.7 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium bromide |
| InChIKey | QPAFJVNEPLDJFR-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C[N+]2=CC3=C(C=C2)SC=C3)Cl.[Br-] |
Computed by PubChem (NCBI)