CAS 731003-83-1 appears in our catalog under these names: 1-((4-Bromo-2-chlorophenyl)sulfonyl)piperazine, 1-(4-Bromo-2-chloro-benzenesulfonyl)-piperazine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g, 250mg, 10g.
1-(4-bromo-2-chlorophenyl)sulfonylpiperazine (CAS 731003-83-1) is a chemical compound with the molecular formula C10H12BrClN2O2S and a molecular weight of 339.64 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)sulfonylpiperazine. InChIKey: VGNMMLAYLPUGHF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O2S |
|---|---|
| Molecular weight | 339.64 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)sulfonylpiperazine |
| InChIKey | VGNMMLAYLPUGHF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)