CAS 731011-84-0 appears in our catalog under these names: Ethyl 3-(2-chloroacetamido)-5-(4-fluorophenyl)thiophene-2-carboxylate, 95%, Ethyl 3-(2-chloroacetamido)-5-(4-fluorophenyl)thiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Ethyl 3-[(2-chloroacetyl)amino]-5-(4-fluorophenyl)thiophene-2-carboxylate (CAS 731011-84-0) is a chemical compound with the molecular formula C15H13ClFNO3S and a molecular weight of 341.8 g/mol. IUPAC name: ethyl 3-[(2-chloroacetyl)amino]-5-(4-fluorophenyl)thiophene-2-carboxylate. InChIKey: FVDJSNGVSMSEQX-UHFFFAOYSA-N.
| Molecular formula | C15H13ClFNO3S |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | ethyl 3-[(2-chloroacetyl)amino]-5-(4-fluorophenyl)thiophene-2-carboxylate |
| InChIKey | FVDJSNGVSMSEQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)F)NC(=O)CCl |
Computed by PubChem (NCBI)