CAS 731011-99-7 appears in our catalog under these names: 1-(Chloroacetyl)-4-[(4-chlorophenyl)sulfonyl]piperazine, 95%, 2-Chloro-1-(4-(4-chlorobenzenesulfonyl)piperazin-1-yl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-chloro-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethanone (CAS 731011-99-7) is a chemical compound with the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.2 g/mol. IUPAC name: 2-chloro-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethanone. InChIKey: MNOHBZYZOODNAZ-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O3S |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 2-chloro-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethanone |
| InChIKey | MNOHBZYZOODNAZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)CCl)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)