CAS 731016-02-7 appears in our catalog under these names: 5-(N-tert-Butylsulfamoyl)-2-methoxyphenylboronic acid, 95%, (5–(N–(tert–Butyl)sulfamoyl)–2–methoxyphenyl)boronic acid, (5-(N-(tert-Butyl)sulfamoyl)-2-methoxyphenyl)boronic acid 97%, 5-(N-tert-butylsulfamoyl)-2-methoxyphenylboronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[5-(tert-butylsulfamoyl)-2-methoxyphenyl]boronic acid (CAS 731016-02-7) is a chemical compound with the molecular formula C11H18BNO5S and a molecular weight of 287.15 g/mol. IUPAC name: [5-(tert-butylsulfamoyl)-2-methoxyphenyl]boronic acid. InChIKey: CFJIYYOPBLWGFP-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO5S |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | [5-(tert-butylsulfamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | CFJIYYOPBLWGFP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)NC(C)(C)C)OC)(O)O |
Computed by PubChem (NCBI)