CAS 731779-03-6 appears in our catalog under these names: N-(3,4-Dichlorophenyl)-4,5-dimethyl-1,3-benzothiazol-2-amine, 95%, N-(3,4-Dichlorophenyl)-4,5-dimethyl-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g.
N-(3,4-dichlorophenyl)-4,5-dimethyl-1,3-benzothiazol-2-amine (CAS 731779-03-6) is a chemical compound with the molecular formula C15H12Cl2N2S and a molecular weight of 323.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-4,5-dimethyl-1,3-benzothiazol-2-amine. InChIKey: SRLIGBBLGUMWLW-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2S |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-4,5-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | SRLIGBBLGUMWLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)SC(=N2)NC3=CC(=C(C=C3)Cl)Cl)C |
Computed by PubChem (NCBI)