CAS 73178-15-1 is the registry number for Dibenzo(b,d)iodol-5-ium 4-methylbenzenesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;4-methylbenzenesulfonate (CAS 73178-15-1) is a chemical compound with the molecular formula C19H15IO3S and a molecular weight of 450.3 g/mol. IUPAC name: 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;4-methylbenzenesulfonate. InChIKey: ZEYIUFCXJRKPRR-UHFFFAOYSA-M.
| Molecular formula | C19H15IO3S |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;4-methylbenzenesulfonate |
| InChIKey | ZEYIUFCXJRKPRR-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C1=CC=C2C(=C1)C3=CC=CC=C3[I+]2 |
Computed by PubChem (NCBI)