CAS 731793-31-0 is the registry number for 4-Chloro-3-{2-((1-methyl-1H-imidazol-2-yl)sulfanyl)acetamido}benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-chloro-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoic acid (CAS 731793-31-0) is a chemical compound with the molecular formula C13H12ClN3O3S and a molecular weight of 325.77 g/mol. IUPAC name: 4-chloro-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoic acid. InChIKey: AHBHBNXIQLXFJC-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O3S |
|---|---|
| Molecular weight | 325.77 g/mol |
| IUPAC name | 4-chloro-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoic acid |
| InChIKey | AHBHBNXIQLXFJC-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1SCC(=O)NC2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)