CAS 7318-55-0 appears in our catalog under these names: (+)-Narwedine, (+)–Narwedine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 10mg.
(1R,12R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one (CAS 7318-55-0) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: (1R,12R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one. InChIKey: QENVUHCAYXAROT-RHSMWYFYSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (1R,12R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one |
| InChIKey | QENVUHCAYXAROT-RHSMWYFYSA-N |
| SMILES | CN1CC[C@]23C=CC(=O)C[C@H]2OC4=C(C=CC(=C34)C1)OC |
Computed by PubChem (NCBI)