CAS 731815-64-8 is the registry number for 1-({4-chloro-5-phenylthieno(2,3-d)pyrimidin-2-yl}methyl)piperidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-5-phenyl-2-(piperidin-1-ylmethyl)thieno[2,3-d]pyrimidine (CAS 731815-64-8) is a chemical compound with the molecular formula C18H18ClN3S and a molecular weight of 343.9 g/mol. IUPAC name: 4-chloro-5-phenyl-2-(piperidin-1-ylmethyl)thieno[2,3-d]pyrimidine. InChIKey: WTFPNFUUVJRTPF-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3S |
|---|---|
| Molecular weight | 343.9 g/mol |
| IUPAC name | 4-chloro-5-phenyl-2-(piperidin-1-ylmethyl)thieno[2,3-d]pyrimidine |
| InChIKey | WTFPNFUUVJRTPF-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=NC3=C(C(=CS3)C4=CC=CC=C4)C(=N2)Cl |
Computed by PubChem (NCBI)