CAS 731862-95-6 is the registry number for [4-(1,1-Dimethylethoxy)-4-oxobutyl]triphenylp hosphonium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-triphenylphosphanium bromide (CAS 731862-95-6) is a chemical compound with the molecular formula C26H30BrO2P and a molecular weight of 485.4 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-triphenylphosphanium bromide. InChIKey: RXLAFGWEFKFVAF-UHFFFAOYSA-M.
| Molecular formula | C26H30BrO2P |
|---|---|
| Molecular weight | 485.4 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-triphenylphosphanium bromide |
| InChIKey | RXLAFGWEFKFVAF-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)