Products 73212-54-1
CAS 73212-54-1 is the registry number for SCH 25393. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-difluoro-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide (CAS 73212-54-1) is a chemical compound with the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. IUPAC name: 2,2-difluoro-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide. InChIKey: KPIOOHZQMFRXOY-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO4S |
|---|---|
| Molecular weight | 325.31 g/mol |
| IUPAC name | 2,2-difluoro-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | KPIOOHZQMFRXOY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(F)F)O |
Computed by PubChem (NCBI)