CAS 73217-10-4 appears in our catalog under these names: 2-Amino-4-oxo-1,7-dihydro-4H-pyrimido[4,5-b][1,4]oxazine-6-carboxylic acid, 95%, 2-Amino-4-oxo-1,7-dihydro-4H-pyrimido[4,5-b][1,4]oxazine-6-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2-amino-4-oxo-3,7-dihydropyrimido[4,5-b][1,4]oxazine-6-carboxylic acid (CAS 73217-10-4) is a chemical compound with the molecular formula C7H6N4O4 and a molecular weight of 210.15 g/mol. IUPAC name: 2-amino-4-oxo-3,7-dihydropyrimido[4,5-b][1,4]oxazine-6-carboxylic acid. InChIKey: NKZSHUSCXICZLP-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O4 |
|---|---|
| Molecular weight | 210.15 g/mol |
| IUPAC name | 2-amino-4-oxo-3,7-dihydropyrimido[4,5-b][1,4]oxazine-6-carboxylic acid |
| InChIKey | NKZSHUSCXICZLP-UHFFFAOYSA-N |
| SMILES | C1C(=NC2=C(O1)N=C(NC2=O)N)C(=O)O |
Computed by PubChem (NCBI)