CAS 732227-92-8 is the registry number for (S)-2-Amino-N-benzyl-N,4-dimethylpentanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-N-benzyl-N,4-dimethylpentanamide (CAS 732227-92-8) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. IUPAC name: (2S)-2-amino-N-benzyl-N,4-dimethylpentanamide. InChIKey: RLBDAOSSJZBCNF-ZDUSSCGKSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | (2S)-2-amino-N-benzyl-N,4-dimethylpentanamide |
| InChIKey | RLBDAOSSJZBCNF-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N(C)CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)