CAS 73226-73-0 appears in our catalog under these names: FR 900098 Monosodium Salt, >95% (HPLC), FR900098 (sodium salt), FR900098 (sodium salt), FR-900098 MONOSODIUM SALT, FR900098 (sodium salt), ≥95%, ≥95%. Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 10 mg, 5 mg, 1 mg.
Sodium 3-[acetyl(hydroxy)amino]propyl-hydroxyphosphinate (CAS 73226-73-0) is a chemical compound with the molecular formula C5H11NNaO5P and a molecular weight of 219.11 g/mol. IUPAC name: sodium 3-[acetyl(hydroxy)amino]propyl-hydroxyphosphinate. InChIKey: LCFXFDGYDKNWMD-UHFFFAOYSA-M.
| Molecular formula | C5H11NNaO5P |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | sodium 3-[acetyl(hydroxy)amino]propyl-hydroxyphosphinate |
| InChIKey | LCFXFDGYDKNWMD-UHFFFAOYSA-M |
| SMILES | CC(=O)N(CCCP(=O)(O)[O-])O.[Na+] |
Computed by PubChem (NCBI)