CAS 732306-24-0 appears in our catalog under these names: 4-Chloro-3-(trifluoromethyl)pyridine hydrochloride, 95%, 4-Chloro-3-(trifluoromethyl)pyridine hydrochloride, 98%, 4-Chloro-3-(trifluoromethyl)pyridine hydrochloride, 97% , 4-Chloro-3-trifluoromethylpyridine hydrochloride. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
4-chloro-3-(trifluoromethyl)pyridine;hydrochloride (CAS 732306-24-0) is a chemical compound with the molecular formula C6H4Cl2F3N and a molecular weight of 218.00 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)pyridine;hydrochloride. InChIKey: HCKXJUZITVCDND-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2F3N |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | HCKXJUZITVCDND-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Cl)C(F)(F)F.Cl |
Computed by PubChem (NCBI)