CAS 732926-20-4 is the registry number for (8–Benzyl–2,4–dioxo–1,3,8–triaza–spiro(4·5)dec–3–yl)–acetic acid. Offered by: GLPBio. Available pack sizes: 1g, 2,5g.
2-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)acetic acid (CAS 732926-20-4) is a chemical compound with the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. IUPAC name: 2-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)acetic acid. InChIKey: SQVWAFNWFNAQLX-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O4 |
|---|---|
| Molecular weight | 317.34 g/mol |
| IUPAC name | 2-(8-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)acetic acid |
| InChIKey | SQVWAFNWFNAQLX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C(=O)N(C(=O)N2)CC(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)