CAS 732939-58-1 appears in our catalog under these names: 6–Sulfonaphthalene–1,4–dicarboxylic acid, 6-SULFONAPHTHALENE-1,4-DICARBOXYLIC ACID, 98%, 98%, 6-Sulfonaphthalene-1,4-dicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-sulfonaphthalene-1,4-dicarboxylic acid (CAS 732939-58-1) is a chemical compound with the molecular formula C12H8O7S and a molecular weight of 296.25 g/mol. IUPAC name: 6-sulfonaphthalene-1,4-dicarboxylic acid. InChIKey: DIXLPXBXYWKJKT-UHFFFAOYSA-N.
| Molecular formula | C12H8O7S |
|---|---|
| Molecular weight | 296.25 g/mol |
| IUPAC name | 6-sulfonaphthalene-1,4-dicarboxylic acid |
| InChIKey | DIXLPXBXYWKJKT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C=C1S(=O)(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)