CAS 733036-96-9 is the registry number for Tafluprost Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-fluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (CAS 733036-96-9) is a chemical compound with the molecular formula C22H29FO5 and a molecular weight of 392.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-fluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid. InChIKey: OQYPTXBTBBSGKZ-UEAHRUCRSA-N.
| Molecular formula | C22H29FO5 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-fluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| InChIKey | OQYPTXBTBBSGKZ-UEAHRUCRSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H]1O)/C=C/[C@H](COC2=CC=CC=C2)F)C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)