CAS 73326-98-4 appears in our catalog under these names: Drpitor1a, Drpitor1a, 96.95%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100 mg, 5 mg, 10mM/1mL, 25 mg.
6H-pyrido[4,3-b]carbazole-5,11-dione (CAS 73326-98-4) is a chemical compound with the molecular formula C15H8N2O2 and a molecular weight of 248.24 g/mol. IUPAC name: 6H-pyrido[4,3-b]carbazole-5,11-dione. InChIKey: KPOPOVJXCUAKLY-UHFFFAOYSA-N.
| Molecular formula | C15H8N2O2 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 6H-pyrido[4,3-b]carbazole-5,11-dione |
| InChIKey | KPOPOVJXCUAKLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)C4=C(C3=O)C=NC=C4 |
Computed by PubChem (NCBI)