CAS 7333-63-3 appears in our catalog under these names: (4-Bromobutyl)triphenylphosphonium bromide, 98%, (4-Bromobutyl)triphenylphosphonium Bromide, (4-Bromobutyl)triphenylphosphonium bromide, 98% , (4-Bromobutyl)triphenylphosphonium bromide 97%, (4-BROMOBUTYL)TRIPHENYLPHOSPHONIUM. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 100g, 5g, 250mg, 10g, 50g, 500g.
4-bromobutyl(triphenyl)phosphanium bromide (CAS 7333-63-3) is a chemical compound with the molecular formula C22H23Br2P and a molecular weight of 478.2 g/mol. IUPAC name: 4-bromobutyl(triphenyl)phosphanium bromide. InChIKey: BJDNCJGRAMGIRU-UHFFFAOYSA-M.
| Molecular formula | C22H23Br2P |
|---|---|
| Molecular weight | 478.2 g/mol |
| IUPAC name | 4-bromobutyl(triphenyl)phosphanium bromide |
| InChIKey | BJDNCJGRAMGIRU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCCBr)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)