CAS 73334-05-1 is the registry number for Metronidazole Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate (CAS 73334-05-1) is a chemical compound with the molecular formula C6H10N3O6P and a molecular weight of 251.13 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate. InChIKey: GFFOAZOYBIIJHI-UHFFFAOYSA-N.
| Molecular formula | C6H10N3O6P |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate |
| InChIKey | GFFOAZOYBIIJHI-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOP(=O)(O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)