Products 73334-05-1

CAS 73334-05-1 is the registry number for Metronidazole Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate (CAS 73334-05-1) is a chemical compound with the molecular formula C6H10N3O6P and a molecular weight of 251.13 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate. InChIKey: GFFOAZOYBIIJHI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N3O6P
Molecular weight251.13 g/mol
IUPAC name2-(2-methyl-5-nitroimidazol-1-yl)ethyl dihydrogen phosphate
InChIKeyGFFOAZOYBIIJHI-UHFFFAOYSA-N
SMILESCC1=NC=C(N1CCOP(=O)(O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)