CAS 73346-91-5 is the registry number for (2S,3R)-3-Bromo-2-butanol acetate. Offered by: Biosynth. Available pack sizes: 500mg.
[(2S,3R)-3-bromobutan-2-yl] acetate (CAS 73346-91-5) is a chemical compound with the molecular formula C6H11BrO2 and a molecular weight of 195.05 g/mol. IUPAC name: [(2S,3R)-3-bromobutan-2-yl] acetate. InChIKey: UAENTLSAGQVMDD-UHNVWZDZSA-N.
| Molecular formula | C6H11BrO2 |
|---|---|
| Molecular weight | 195.05 g/mol |
| IUPAC name | [(2S,3R)-3-bromobutan-2-yl] acetate |
| InChIKey | UAENTLSAGQVMDD-UHNVWZDZSA-N |
| SMILES | C[C@@H]([C@@H](C)Br)OC(=O)C |
Computed by PubChem (NCBI)