CAS 733762-43-1 appears in our catalog under these names: 6-(Piperidine-1-sulfonyl)-1H-1,2,3-benzotriazol-1-ol, 6-(Piperidine-1-sulfonyl)-1h-1,2,3-benzotriazol-1-ol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
1-hydroxy-6-piperidin-1-ylsulfonylbenzotriazole (CAS 733762-43-1) is a chemical compound with the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. IUPAC name: 1-hydroxy-6-piperidin-1-ylsulfonylbenzotriazole. InChIKey: SZUMYZPHCJEKMI-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O3S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 1-hydroxy-6-piperidin-1-ylsulfonylbenzotriazole |
| InChIKey | SZUMYZPHCJEKMI-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)N=NN3O |
Computed by PubChem (NCBI)