CAS 733794-76-8 is the registry number for 1-({4-chloro-5,6-dimethylthieno(2,3-d)pyrimidin-2-yl}methyl)pyrrolidine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-5,6-dimethyl-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidine (CAS 733794-76-8) is a chemical compound with the molecular formula C13H16ClN3S and a molecular weight of 281.80 g/mol. IUPAC name: 4-chloro-5,6-dimethyl-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidine. InChIKey: OQXIHVZAXNRASY-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3S |
|---|---|
| Molecular weight | 281.80 g/mol |
| IUPAC name | 4-chloro-5,6-dimethyl-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidine |
| InChIKey | OQXIHVZAXNRASY-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC(=N2)CN3CCCC3)Cl)C |
Computed by PubChem (NCBI)