CAS 73452-52-5 is the registry number for N-Hydroxy-p,p-diphenylphosphinic amide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-diphenylphosphorylhydroxylamine (CAS 73452-52-5) is a chemical compound with the molecular formula C12H12NO2P and a molecular weight of 233.20 g/mol. IUPAC name: N-diphenylphosphorylhydroxylamine. InChIKey: NJKRDPIHNOWVJI-UHFFFAOYSA-N.
| Molecular formula | C12H12NO2P |
|---|---|
| Molecular weight | 233.20 g/mol |
| IUPAC name | N-diphenylphosphorylhydroxylamine |
| InChIKey | NJKRDPIHNOWVJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)NO |
Computed by PubChem (NCBI)