CAS 7346-67-0 is the registry number for Sodium cyclohexyl(ethyl)carbamodithioate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 2,5g.
Sodium N-cyclohexyl-N-ethylcarbamodithioate (CAS 7346-67-0) is a chemical compound with the molecular formula C9H16NNaS2 and a molecular weight of 225.4 g/mol. IUPAC name: sodium N-cyclohexyl-N-ethylcarbamodithioate. InChIKey: OSFXFAMIJHXFIL-UHFFFAOYSA-M.
| Molecular formula | C9H16NNaS2 |
|---|---|
| Molecular weight | 225.4 g/mol |
| IUPAC name | sodium N-cyclohexyl-N-ethylcarbamodithioate |
| InChIKey | OSFXFAMIJHXFIL-UHFFFAOYSA-M |
| SMILES | CCN(C1CCCCC1)C(=S)[S-].[Na+] |
Computed by PubChem (NCBI)