CAS 73473-56-0 is the registry number for Cyclopenta(cd)pyren-4(3H)-one. Offered by: TRC. Available pack sizes: 25mg.
Pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(18),4(17),5,7(16),8,10(15),11,13-octaen-2-one (CAS 73473-56-0) is a chemical compound with the molecular formula C18H10O and a molecular weight of 242.3 g/mol. IUPAC name: pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(18),4(17),5,7(16),8,10(15),11,13-octaen-2-one. InChIKey: GCPKMXIIQAZQLQ-UHFFFAOYSA-N.
| Molecular formula | C18H10O |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(18),4(17),5,7(16),8,10(15),11,13-octaen-2-one |
| InChIKey | GCPKMXIIQAZQLQ-UHFFFAOYSA-N |
| SMILES | C1C2=C3C(=CC4=CC=CC5=C4C3=C(C=C2)C=C5)C1=O |
Computed by PubChem (NCBI)