CAS 73491-36-8 is the registry number for Thallium(I) Trifluoromethanesulfonate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
Thallium(1+);trifluoromethanesulfonate (CAS 73491-36-8) is a chemical compound with the molecular formula CF3O3STl and a molecular weight of 353.46 g/mol. IUPAC name: thallium(1+);trifluoromethanesulfonate. InChIKey: PDFSYPYWCONFDC-UHFFFAOYSA-M.
| Molecular formula | CF3O3STl |
|---|---|
| Molecular weight | 353.46 g/mol |
| IUPAC name | thallium(1+);trifluoromethanesulfonate |
| InChIKey | PDFSYPYWCONFDC-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].[Tl+] |
Computed by PubChem (NCBI)