CAS 7350-88-1 appears in our catalog under these names: Perylene-3-carboxylic acid, 95%, 3-Perylenecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg.
Perylene-3-carboxylic acid (CAS 7350-88-1) is a chemical compound with the molecular formula C21H12O2 and a molecular weight of 296.3 g/mol. IUPAC name: perylene-3-carboxylic acid. InChIKey: IIZGWPQZWKLJOI-UHFFFAOYSA-N.
| Molecular formula | C21H12O2 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | perylene-3-carboxylic acid |
| InChIKey | IIZGWPQZWKLJOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=C5C(=CC=C4)C(=CC=C5C3=CC=C2)C(=O)O |
Computed by PubChem (NCBI)