Products 735273-33-3
CAS 735273-33-3 is the registry number for α-Glucosidase-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-4-(4-hydroxyphenyl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile (CAS 735273-33-3) is a chemical compound with the molecular formula C19H12N4OS and a molecular weight of 344.4 g/mol. IUPAC name: 2-amino-4-(4-hydroxyphenyl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile. InChIKey: QHIVQLWARGZMHH-UHFFFAOYSA-N.
| Molecular formula | C19H12N4OS |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-amino-4-(4-hydroxyphenyl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
| InChIKey | QHIVQLWARGZMHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C(=C(C(=N2)N)C#N)C3=CC=C(C=C3)O)C#N |
Computed by PubChem (NCBI)