CAS 735322-08-4 is the registry number for 5-[Benzyl-(2-chloro-phenyl)-sulfamoyl]-2-chloro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-[benzyl-(2-chlorophenyl)sulfamoyl]-2-chlorobenzoic acid (CAS 735322-08-4) is a chemical compound with the molecular formula C20H15Cl2NO4S and a molecular weight of 436.3 g/mol. IUPAC name: 5-[benzyl-(2-chlorophenyl)sulfamoyl]-2-chlorobenzoic acid. InChIKey: JADXAIGOQPLWFB-UHFFFAOYSA-N.
| Molecular formula | C20H15Cl2NO4S |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | 5-[benzyl-(2-chlorophenyl)sulfamoyl]-2-chlorobenzoic acid |
| InChIKey | JADXAIGOQPLWFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2Cl)S(=O)(=O)C3=CC(=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)