Products 735322-09-5
CAS 735322-09-5 appears in our catalog under these names: 3-(5-Diethylsulfamoyl-1-ethyl-1h-benzoimidazol-2-yl)-propionic acid, 95%, 3-(5-(Diethylsulfamoyl)-1-ethyl-1H-1,3-benzodiazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoic acid (CAS 735322-09-5) is a chemical compound with the molecular formula C16H23N3O4S and a molecular weight of 353.4 g/mol. IUPAC name: 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoic acid. InChIKey: ZFXCTCCKWQDCIC-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoic acid |
| InChIKey | ZFXCTCCKWQDCIC-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)N(CC)CC)N=C1CCC(=O)O |
Computed by PubChem (NCBI)